C10H12F2N2 — CID 83531554
2-(2,4-difluorophenyl)pyrrolidin-1-amine (PubChem CID 83531554) has the molecular formula C10H12F2N2 and a molecular weight of 198.22 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)pyrrolidin-1-amine.
| Compound Name | 2-(2,4-difluorophenyl)pyrrolidin-1-amine |
|---|---|
| PubChem CID | 83531554 |
| Molecular Formula | C10H12F2N2 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 2-(2,4-difluorophenyl)pyrrolidin-1-amine |
| SMILES | NN1CCCC1c1ccc(F)cc1F |
| InChI | InChI=1S/C10H12F2N2/c11-7-3-4-8(9(12)6-7)10-2-1-5-14(10)13/h3-4,6,10H,1-2,5,13H2 |
| InChIKey | ZTBGIBQOZYMSFP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|