C17H21F2NO3S — CID 158337331
[2-(2,4-difluorophenyl)piperidin-1-yl]-(1,1-dioxothian-4-yl)methanone (PubChem CID 158337331) has the molecular formula C17H21F2NO3S and a molecular weight of 357.42 g/mol. Its IUPAC name is [2-(2,4-difluorophenyl)piperidin-1-yl]-(1,1-dioxothian-4-yl)methanone.
| Compound Name | [2-(2,4-difluorophenyl)piperidin-1-yl]-(1,1-dioxothian-4-yl)methanone |
|---|---|
| PubChem CID | 158337331 |
| Molecular Formula | C17H21F2NO3S |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | [2-(2,4-difluorophenyl)piperidin-1-yl]-(1,1-dioxothian-4-yl)methanone |
| SMILES | O=C(C1CCS(=O)(=O)CC1)N1CCCCC1c1ccc(F)cc1F |
| InChI | InChI=1S/C17H21F2NO3S/c18-13-4-5-14(15(19)11-13)16-3-1-2-8-20(16)17(21)12-6-9-24(22,23)10-7-12/h4-5,11-12,16H,1-3,6-10H2 |
| InChIKey | GQSYKTSZMIQPNJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |