C20H21F2N3O3 — CID 154250205
2-(2,4-difluorophenyl)-N-[[4-(hydroxycarbamoyl)phenyl]methyl]piperidine-1-carboxamide (PubChem CID 154250205) has the molecular formula C20H21F2N3O3 and a molecular weight of 389.40 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-N-[[4-(hydroxycarbamoyl)phenyl]methyl]piperidine-1-carboxamide.
| Compound Name | 2-(2,4-difluorophenyl)-N-[[4-(hydroxycarbamoyl)phenyl]methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 154250205 |
| Molecular Formula | C20H21F2N3O3 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 2-(2,4-difluorophenyl)-N-[[4-(hydroxycarbamoyl)phenyl]methyl]piperidine-1-carboxamide |
| SMILES | O=C(NO)c1ccc(CNC(=O)N2CCCCC2c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C20H21F2N3O3/c21-15-8-9-16(17(22)11-15)18-3-1-2-10-25(18)20(27)23-12-13-4-6-14(7-5-13)19(26)24-28/h4-9,11,18,28H,1-3,10,12H2,(H,23,27)(H,24,26) |
| InChIKey | IXDYFKKHSASBAF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|