C13H15NO2 — CID 83534675
[cyano-(2,4,6-trimethylphenyl)methyl] acetate (PubChem CID 83534675) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is [cyano-(2,4,6-trimethylphenyl)methyl] acetate.
| Compound Name | [cyano-(2,4,6-trimethylphenyl)methyl] acetate |
|---|---|
| PubChem CID | 83534675 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | [cyano-(2,4,6-trimethylphenyl)methyl] acetate |
| SMILES | CC(=O)OC(C#N)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C13H15NO2/c1-8-5-9(2)13(10(3)6-8)12(7-14)16-11(4)15/h5-6,12H,1-4H3 |
| InChIKey | PHAHADSXHVIBTH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |