C14H17NO — CID 83704521
4-oxo-2-(2,4,6-trimethylphenyl)pentanenitrile (PubChem CID 83704521) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is 4-oxo-2-(2,4,6-trimethylphenyl)pentanenitrile.
| Compound Name | 4-oxo-2-(2,4,6-trimethylphenyl)pentanenitrile |
|---|---|
| PubChem CID | 83704521 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 4-oxo-2-(2,4,6-trimethylphenyl)pentanenitrile |
| SMILES | CC(=O)CC(C#N)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C14H17NO/c1-9-5-10(2)14(11(3)6-9)13(8-15)7-12(4)16/h5-6,13H,7H2,1-4H3 |
| InChIKey | UGNYXQXAOFHSCM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |