C8H14N4O — CID 83617588
N-(2-aminoethyl)-1,4-dimethylpyrazole-3-carboxamide (PubChem CID 83617588) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is N-(2-aminoethyl)-1,4-dimethylpyrazole-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-1,4-dimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 83617588 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | N-(2-aminoethyl)-1,4-dimethylpyrazole-3-carboxamide |
| SMILES | Cc1cn(C)nc1C(=O)NCCN |
| InChI | InChI=1S/C8H14N4O/c1-6-5-12(2)11-7(6)8(13)10-4-3-9/h5H,3-4,9H2,1-2H3,(H,10,13) |
| InChIKey | BMZSMVPDODCGQI-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |