C10H14N2O2 — CID 83619262
1-(3-aminopyrrolidin-1-yl)-2-(furan-2-yl)ethanone (PubChem CID 83619262) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 1-(3-aminopyrrolidin-1-yl)-2-(furan-2-yl)ethanone.
| Compound Name | 1-(3-aminopyrrolidin-1-yl)-2-(furan-2-yl)ethanone |
|---|---|
| PubChem CID | 83619262 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 1-(3-aminopyrrolidin-1-yl)-2-(furan-2-yl)ethanone |
| SMILES | NC1CCN(C(=O)Cc2ccco2)C1 |
| InChI | InChI=1S/C10H14N2O2/c11-8-3-4-12(7-8)10(13)6-9-2-1-5-14-9/h1-2,5,8H,3-4,6-7,11H2 |
| InChIKey | VXFOAIZUNKHXBN-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |