C6H10BrN3 — CID 83638263
2-(4-bromo-2-methyl-1H-imidazol-5-yl)ethanamine (PubChem CID 83638263) has the molecular formula C6H10BrN3 and a molecular weight of 204.07 g/mol. Its IUPAC name is 2-(4-bromo-2-methyl-1H-imidazol-5-yl)ethanamine.
| Compound Name | 2-(4-bromo-2-methyl-1H-imidazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 83638263 |
| Molecular Formula | C6H10BrN3 |
| Molecular Weight | 204.07 g/mol |
| Exact Mass | 203.01 |
| IUPAC Name | 2-(4-bromo-2-methyl-1H-imidazol-5-yl)ethanamine |
| SMILES | Cc1nc(Br)c(CCN)[nH]1 |
| InChI | InChI=1S/C6H10BrN3/c1-4-9-5(2-3-8)6(7)10-4/h2-3,8H2,1H3,(H,9,10) |
| InChIKey | LWXSFYYSLFKPMR-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.07 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |