About 3-tert-butyl-[1,2,4]triazolo[4,3-a]pyridine-7-carboxylic acid
3-tert-butyl-[1,2,4]triazolo[4,3-a]pyridine-7-carboxylic acid (PubChem CID 83641424) has the molecular formula C11H13N3O2
and a molecular weight of 219.24 g/mol. Its IUPAC name is 3-tert-butyl-[1,2,4]triazolo[4,3-a]pyridine-7-carboxylic acid.
Analyze 3-tert-butyl-[1,2,4]triazolo[4,3-a]pyridine-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-[1,2,4]triazolo[4,3-a]pyridine-7-carboxylic acid?
The IUPAC name of 3-tert-butyl-[1,2,4]triazolo[4,3-a]pyridine-7-carboxylic acid (CID 83641424) is 3-tert-butyl-[1,2,4]triazolo[4,3-a]pyridine-7-carboxylic acid.
What is the SMILES notation for 3-tert-butyl-[1,2,4]triazolo[4,3-a]pyridine-7-carboxylic acid?
The canonical SMILES for 3-tert-butyl-[1,2,4]triazolo[4,3-a]pyridine-7-carboxylic acid is CC(C)(C)c1nnc2cc(C(=O)O)ccn12.
What is the InChIKey of 3-tert-butyl-[1,2,4]triazolo[4,3-a]pyridine-7-carboxylic acid?
The InChIKey is KEOWNUASZPVHJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O2/c1-11(2,3)10-13-12-8-6-7(9(15)16)4-5-14(8)10/h4-6H,1-3H3,(H,15,16).
What are the key properties of 3-tert-butyl-[1,2,4]triazolo[4,3-a]pyridine-7-carboxylic acid?
3-tert-butyl-[1,2,4]triazolo[4,3-a]pyridine-7-carboxylic acid has a molecular weight of 219.24 g/mol, XLogP of 1.73, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-[1,2,4]triazolo[4,3-a]pyridine-7-carboxylic acid is sourced from PubChem (CID 83641424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).