C12H15N3O — CID 83887597
2-(3-tert-butyl-[1,2,4]triazolo[4,3-a]pyridin-7-yl)acetaldehyde (PubChem CID 83887597) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-(3-tert-butyl-[1,2,4]triazolo[4,3-a]pyridin-7-yl)acetaldehyde.
| Compound Name | 2-(3-tert-butyl-[1,2,4]triazolo[4,3-a]pyridin-7-yl)acetaldehyde |
|---|---|
| PubChem CID | 83887597 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 2-(3-tert-butyl-[1,2,4]triazolo[4,3-a]pyridin-7-yl)acetaldehyde |
| SMILES | CC(C)(C)c1nnc2cc(CC=O)ccn12 |
| InChI | InChI=1S/C12H15N3O/c1-12(2,3)11-14-13-10-8-9(5-7-16)4-6-15(10)11/h4,6-8H,5H2,1-3H3 |
| InChIKey | NOQYLZIJGQVPKY-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|