C16H27N4+ — CID 58465369
3-tert-butyl-7-(2,3,3-trimethylbutan-2-yl)-[1,2,4]triazolo[4,3-a]pyrazin-7-ium (PubChem CID 58465369) has the molecular formula C16H27N4+ and a molecular weight of 275.42 g/mol. Its IUPAC name is 3-tert-butyl-7-(2,3,3-trimethylbutan-2-yl)-[1,2,4]triazolo[4,3-a]pyrazin-7-ium.
| Compound Name | 3-tert-butyl-7-(2,3,3-trimethylbutan-2-yl)-[1,2,4]triazolo[4,3-a]pyrazin-7-ium |
|---|---|
| PubChem CID | 58465369 |
| Molecular Formula | C16H27N4+ |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | 3-tert-butyl-7-(2,3,3-trimethylbutan-2-yl)-[1,2,4]triazolo[4,3-a]pyrazin-7-ium |
| SMILES | CC(C)(C)c1nnc2c[n+](C(C)(C)C(C)(C)C)ccn12 |
| InChI | InChI=1S/C16H27N4/c1-14(2,3)13-18-17-12-11-19(9-10-20(12)13)16(7,8)15(4,5)6/h9-11H,1-8H3/q+1 |
| InChIKey | HXTKYCNELFWEGM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 34.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|