C11H15N3O — CID 117145572
3-tert-butyl-8-methoxy-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 117145572) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 3-tert-butyl-8-methoxy-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-tert-butyl-8-methoxy-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 117145572 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 3-tert-butyl-8-methoxy-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | COc1cccn2c(C(C)(C)C)nnc12 |
| InChI | InChI=1S/C11H15N3O/c1-11(2,3)10-13-12-9-8(15-4)6-5-7-14(9)10/h5-7H,1-4H3 |
| InChIKey | QFPFLQBUBJAWPT-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |