C7H7BrN4 — CID 169217326
7-(bromomethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-amine (PubChem CID 169217326) has the molecular formula C7H7BrN4 and a molecular weight of 227.06 g/mol. Its IUPAC name is 7-(bromomethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-amine.
| Compound Name | 7-(bromomethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-amine |
|---|---|
| PubChem CID | 169217326 |
| Molecular Formula | C7H7BrN4 |
| Molecular Weight | 227.06 g/mol |
| Exact Mass | 225.99 |
| IUPAC Name | 7-(bromomethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-amine |
| SMILES | Nc1nnc2cc(CBr)ccn12 |
| InChI | InChI=1S/C7H7BrN4/c8-4-5-1-2-12-6(3-5)10-11-7(12)9/h1-3H,4H2,(H2,9,11) |
| InChIKey | CGKWLLBSAMVSDI-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.06 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|