C8H15NO2 — CID 83669924
4,4-dimethylpiperidine-3-carboxylic acid (PubChem CID 83669924) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is 4,4-dimethylpiperidine-3-carboxylic acid.
| Compound Name | 4,4-dimethylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 83669924 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | 4,4-dimethylpiperidine-3-carboxylic acid |
| SMILES | CC1(C)CCNCC1C(=O)O |
| InChI | InChI=1S/C8H15NO2/c1-8(2)3-4-9-5-6(8)7(10)11/h6,9H,3-5H2,1-2H3,(H,10,11) |
| InChIKey | CUBYRZGUSVVPJA-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |