8-azaspiro[4.5]decane-10-carboxylic acid

C10H17NO2 — CID 91278637

IUPAC8-azaspiro[4.5]decane-10-carboxylic acid
SMILESO=C(O)C1CNCCC12CCCC2
InChIInChI=1S/C10H17NO2/c12-9(13)8-7-11-6-5-10(8)3-1-2-4-10/h8,11H,1-7H2,(H,12,13)
InChIKeyLXDDJHDCCZPOOQ-UHFFFAOYSA-N
MW183.25 g/mol
LogP1.24
Rot. Bonds1

About 8-azaspiro[4.5]decane-10-carboxylic acid

8-azaspiro[4.5]decane-10-carboxylic acid (PubChem CID 91278637) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 8-azaspiro[4.5]decane-10-carboxylic acid.

Molecular Properties

Compound Name8-azaspiro[4.5]decane-10-carboxylic acid
PubChem CID91278637
Molecular FormulaC10H17NO2
Molecular Weight183.25 g/mol
Exact Mass183.13
IUPAC Name8-azaspiro[4.5]decane-10-carboxylic acid
SMILESO=C(O)C1CNCCC12CCCC2
InChIInChI=1S/C10H17NO2/c12-9(13)8-7-11-6-5-10(8)3-1-2-4-10/h8,11H,1-7H2,(H,12,13)
InChIKeyLXDDJHDCCZPOOQ-UHFFFAOYSA-N
XLogP1.24
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500183.25
LogP ≤ 51.24
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 8-azaspiro[4.5]decane-10-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

4,4-dimethylpiperidine-3-carboxylic acid
CID 83669924
6-azaspiro[2.5]octane-2-carboxylic acid
CID 51342230
spiro[5.6]dodecane-12-carboxylic acid
CID 59513338
5-azaspiro[2.5]octane-2-carboxylic acid;hydrochloride
CID 122163372
8-methyl-2-azaspiro[4.6]undecane-4-carboxylic acid
CID 65082433
(2R)-spiro[2.5]octane-2-carboxylic acid
CID 10419388
spiro[3.4]octane-8-carboxylic acid
CID 83905140
8-azaspiro[4.5]decane-4-carboxamide
CID 69178450
tert-butyl N-(8-azaspiro[4.5]decan-10-yl)carbamate
CID 83680565
6-oxo-7-azaspiro[3.5]nonane-9-carboxylic acid
CID 126847405
(5R,9R)-2-oxa-7-azaspiro[4.4]nonane-9-carboxylic acid
CID 95255158
2,2-dimethyl-6-azaspiro[3.4]octane-8-carboxylic acid
CID 131143190

Frequently Asked Questions

What is the IUPAC name of 8-azaspiro[4.5]decane-10-carboxylic acid?
The IUPAC name of 8-azaspiro[4.5]decane-10-carboxylic acid (CID 91278637) is 8-azaspiro[4.5]decane-10-carboxylic acid.
What is the SMILES notation for 8-azaspiro[4.5]decane-10-carboxylic acid?
The canonical SMILES for 8-azaspiro[4.5]decane-10-carboxylic acid is O=C(O)C1CNCCC12CCCC2.
What is the InChIKey of 8-azaspiro[4.5]decane-10-carboxylic acid?
The InChIKey is LXDDJHDCCZPOOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2/c12-9(13)8-7-11-6-5-10(8)3-1-2-4-10/h8,11H,1-7H2,(H,12,13).
What are the key properties of 8-azaspiro[4.5]decane-10-carboxylic acid?
8-azaspiro[4.5]decane-10-carboxylic acid has a molecular weight of 183.25 g/mol, XLogP of 1.24, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-azaspiro[4.5]decane-10-carboxylic acid is sourced from PubChem (CID 91278637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).