About 3-ethyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one
3-ethyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 83670995) has the molecular formula C9H13N3O
and a molecular weight of 179.22 g/mol. Its IUPAC name is 3-ethyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
Analyze 3-ethyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one?
The IUPAC name of 3-ethyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (CID 83670995) is 3-ethyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
What is the SMILES notation for 3-ethyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one?
The canonical SMILES for 3-ethyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one is CCn1cnc2c(c1=O)CNCC2.
What is the InChIKey of 3-ethyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one?
The InChIKey is RPMOJQHORNOWFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O/c1-2-12-6-11-8-3-4-10-5-7(8)9(12)13/h6,10H,2-5H2,1H3.
What are the key properties of 3-ethyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one?
3-ethyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one has a molecular weight of 179.22 g/mol, XLogP of -0.09, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one is sourced from PubChem (CID 83670995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).