C12H20N4O3 — CID 83672007
tert-butyl N-[2-[5-(aminomethyl)-6-oxo-1H-pyrimidin-2-yl]ethyl]carbamate (PubChem CID 83672007) has the molecular formula C12H20N4O3 and a molecular weight of 268.32 g/mol. Its IUPAC name is tert-butyl N-[2-[5-(aminomethyl)-6-oxo-1H-pyrimidin-2-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[5-(aminomethyl)-6-oxo-1H-pyrimidin-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 83672007 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | tert-butyl N-[2-[5-(aminomethyl)-6-oxo-1H-pyrimidin-2-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1ncc(CN)c(=O)[nH]1 |
| InChI | InChI=1S/C12H20N4O3/c1-12(2,3)19-11(18)14-5-4-9-15-7-8(6-13)10(17)16-9/h7H,4-6,13H2,1-3H3,(H,14,18)(H,15,16,17) |
| InChIKey | RYJBOPSNGMQCDQ-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |