About [2-(aminomethyl)-4-methyl-1,3-thiazol-5-yl]methanol
[2-(aminomethyl)-4-methyl-1,3-thiazol-5-yl]methanol (PubChem CID 83679321) has the molecular formula C6H10N2OS
and a molecular weight of 158.23 g/mol. Its IUPAC name is [2-(aminomethyl)-4-methyl-1,3-thiazol-5-yl]methanol.
Analyze [2-(aminomethyl)-4-methyl-1,3-thiazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(aminomethyl)-4-methyl-1,3-thiazol-5-yl]methanol?
The IUPAC name of [2-(aminomethyl)-4-methyl-1,3-thiazol-5-yl]methanol (CID 83679321) is [2-(aminomethyl)-4-methyl-1,3-thiazol-5-yl]methanol.
What is the SMILES notation for [2-(aminomethyl)-4-methyl-1,3-thiazol-5-yl]methanol?
The canonical SMILES for [2-(aminomethyl)-4-methyl-1,3-thiazol-5-yl]methanol is Cc1nc(CN)sc1CO.
What is the InChIKey of [2-(aminomethyl)-4-methyl-1,3-thiazol-5-yl]methanol?
The InChIKey is MWBFTDDSTGSZSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2OS/c1-4-5(3-9)10-6(2-7)8-4/h9H,2-3,7H2,1H3.
What are the key properties of [2-(aminomethyl)-4-methyl-1,3-thiazol-5-yl]methanol?
[2-(aminomethyl)-4-methyl-1,3-thiazol-5-yl]methanol has a molecular weight of 158.23 g/mol, XLogP of 0.40, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(aminomethyl)-4-methyl-1,3-thiazol-5-yl]methanol is sourced from PubChem (CID 83679321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).