C9H12FNO — CID 83695306
2-amino-1-(3-fluoro-2-methylphenyl)ethanol (PubChem CID 83695306) has the molecular formula C9H12FNO and a molecular weight of 169.20 g/mol. Its IUPAC name is 2-amino-1-(3-fluoro-2-methylphenyl)ethanol.
| Compound Name | 2-amino-1-(3-fluoro-2-methylphenyl)ethanol |
|---|---|
| PubChem CID | 83695306 |
| Molecular Formula | C9H12FNO |
| Molecular Weight | 169.20 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 2-amino-1-(3-fluoro-2-methylphenyl)ethanol |
| SMILES | Cc1c(F)cccc1C(O)CN |
| InChI | InChI=1S/C9H12FNO/c1-6-7(9(12)5-11)3-2-4-8(6)10/h2-4,9,12H,5,11H2,1H3 |
| InChIKey | SWNZSVRECUHPOV-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.20 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |