C8H3BrN2OS — CID 83730176
5-(5-bromothiophen-2-yl)-1,2-oxazole-4-carbonitrile (PubChem CID 83730176) has the molecular formula C8H3BrN2OS and a molecular weight of 255.10 g/mol. Its IUPAC name is 5-(5-bromothiophen-2-yl)-1,2-oxazole-4-carbonitrile.
| Compound Name | 5-(5-bromothiophen-2-yl)-1,2-oxazole-4-carbonitrile |
|---|---|
| PubChem CID | 83730176 |
| Molecular Formula | C8H3BrN2OS |
| Molecular Weight | 255.10 g/mol |
| Exact Mass | 253.91 |
| IUPAC Name | 5-(5-bromothiophen-2-yl)-1,2-oxazole-4-carbonitrile |
| SMILES | N#Cc1cnoc1-c1ccc(Br)s1 |
| InChI | InChI=1S/C8H3BrN2OS/c9-7-2-1-6(13-7)8-5(3-10)4-11-12-8/h1-2,4H |
| InChIKey | GHPYJIYIFWSEDD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.10 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |