C14H4BBrN2S3 — CID 88974045
CID 88974045 (PubChem CID 88974045) has the molecular formula C14H4BBrN2S3 and a molecular weight of 387.12 g/mol.
| Compound Name | CID 88974045 |
|---|---|
| PubChem CID | 88974045 |
| Molecular Formula | C14H4BBrN2S3 |
| Molecular Weight | 387.12 g/mol |
| Exact Mass | 385.88 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(-c2sc(-c3ccc(Br)s3)c(C#N)c2C#N)s1 |
| InChI | InChI=1S/C14H4BBrN2S3/c15-11-3-1-9(19-11)13-7(5-17)8(6-18)14(21-13)10-2-4-12(16)20-10/h1-4H |
| InChIKey | HSGJKQSZASVKDW-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.12 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|