About 4-bromo-5-(2,4-dimethylphenyl)-1,3-dimethylpyrazole
4-bromo-5-(2,4-dimethylphenyl)-1,3-dimethylpyrazole (PubChem CID 83745555) has the molecular formula C13H15BrN2
and a molecular weight of 279.18 g/mol. Its IUPAC name is 4-bromo-5-(2,4-dimethylphenyl)-1,3-dimethylpyrazole.
Molecular Properties
| Compound Name | 4-bromo-5-(2,4-dimethylphenyl)-1,3-dimethylpyrazole |
| PubChem CID | 83745555 |
| Molecular Formula | C13H15BrN2 |
| Molecular Weight | 279.18 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 4-bromo-5-(2,4-dimethylphenyl)-1,3-dimethylpyrazole |
| SMILES | Cc1ccc(-c2c(Br)c(C)nn2C)c(C)c1 |
| InChI | InChI=1S/C13H15BrN2/c1-8-5-6-11(9(2)7-8)13-12(14)10(3)15-16(13)4/h5-7H,1-4H3 |
| InChIKey | IVYLFACKKGLLAS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.18 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-5-(2,4-dimethylphenyl)-1,3-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-5-(2,4-dimethylphenyl)-1,3-dimethylpyrazole?
The IUPAC name of 4-bromo-5-(2,4-dimethylphenyl)-1,3-dimethylpyrazole (CID 83745555) is 4-bromo-5-(2,4-dimethylphenyl)-1,3-dimethylpyrazole.
What is the SMILES notation for 4-bromo-5-(2,4-dimethylphenyl)-1,3-dimethylpyrazole?
The canonical SMILES for 4-bromo-5-(2,4-dimethylphenyl)-1,3-dimethylpyrazole is Cc1ccc(-c2c(Br)c(C)nn2C)c(C)c1.
What is the InChIKey of 4-bromo-5-(2,4-dimethylphenyl)-1,3-dimethylpyrazole?
The InChIKey is IVYLFACKKGLLAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15BrN2/c1-8-5-6-11(9(2)7-8)13-12(14)10(3)15-16(13)4/h5-7H,1-4H3.
What are the key properties of 4-bromo-5-(2,4-dimethylphenyl)-1,3-dimethylpyrazole?
4-bromo-5-(2,4-dimethylphenyl)-1,3-dimethylpyrazole has a molecular weight of 279.18 g/mol, XLogP of 3.77, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-5-(2,4-dimethylphenyl)-1,3-dimethylpyrazole is sourced from PubChem (CID 83745555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).