About 2'-Hydroxyacetophenone
2'-Hydroxyacetophenone (PubChem CID 8375) has the molecular formula C8H8O2
and a molecular weight of 136.15 g/mol. Its IUPAC name is 1-(2-hydroxyphenyl)ethanone.
Molecular Properties
| Compound Name | 2'-Hydroxyacetophenone |
| PubChem CID | 8375 |
| Molecular Formula | C8H8O2 |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.05 |
| IUPAC Name | 1-(2-hydroxyphenyl)ethanone |
| SMILES | CC(=O)C1=CC=CC=C1O |
| InChI | InChI=1S/C8H8O2/c1-6(9)7-4-2-3-5-8(7)10/h2-5,10H,1H3 |
| InChIKey | JECYUBVRTQDVAT-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | 131 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2'-Hydroxyacetophenone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2'-Hydroxyacetophenone?
The IUPAC name of 2'-Hydroxyacetophenone (CID 8375) is 1-(2-hydroxyphenyl)ethanone.
What is the SMILES notation for 2'-Hydroxyacetophenone?
The canonical SMILES for 2'-Hydroxyacetophenone is CC(=O)C1=CC=CC=C1O.
What is the InChIKey of 2'-Hydroxyacetophenone?
The InChIKey is JECYUBVRTQDVAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2/c1-6(9)7-4-2-3-5-8(7)10/h2-5,10H,1H3.
What are the key properties of 2'-Hydroxyacetophenone?
2'-Hydroxyacetophenone has a molecular weight of 136.15 g/mol, XLogP of 1.90, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2'-Hydroxyacetophenone is sourced from PubChem (CID 8375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).