About 3-Methylsalicylic Acid
3-Methylsalicylic Acid (PubChem CID 6738) has the molecular formula C8H8O3
and a molecular weight of 152.15 g/mol. Its IUPAC name is 2-hydroxy-3-methylbenzoic acid.
Molecular Properties
| Compound Name | 3-Methylsalicylic Acid |
| PubChem CID | 6738 |
| Molecular Formula | C8H8O3 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | 2-hydroxy-3-methylbenzoic acid |
| SMILES | CC1=C(C(=CC=C1)C(=O)O)O |
| InChI | InChI=1S/C8H8O3/c1-5-3-2-4-6(7(5)9)8(10)11/h2-4,9H,1H3,(H,10,11) |
| InChIKey | WHSXTWFYRGOBGO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | 155 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-Methylsalicylic Acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-Methylsalicylic Acid?
The IUPAC name of 3-Methylsalicylic Acid (CID 6738) is 2-hydroxy-3-methylbenzoic acid.
What is the SMILES notation for 3-Methylsalicylic Acid?
The canonical SMILES for 3-Methylsalicylic Acid is CC1=C(C(=CC=C1)C(=O)O)O.
What is the InChIKey of 3-Methylsalicylic Acid?
The InChIKey is WHSXTWFYRGOBGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3/c1-5-3-2-4-6(7(5)9)8(10)11/h2-4,9H,1H3,(H,10,11).
What are the key properties of 3-Methylsalicylic Acid?
3-Methylsalicylic Acid has a molecular weight of 152.15 g/mol, XLogP of 2.90, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-Methylsalicylic Acid is sourced from PubChem (CID 6738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).