About Salicylate
Salicylate (PubChem CID 54675850) has the molecular formula C7H5O3-
and a molecular weight of 137.11 g/mol. Its IUPAC name is 2-carboxyphenolate.
Molecular Properties
| Compound Name | Salicylate |
| PubChem CID | 54675850 |
| Molecular Formula | C7H5O3- |
| Molecular Weight | 137.11 g/mol |
| Exact Mass | 137.02 |
| IUPAC Name | 2-carboxyphenolate |
| SMILES | C1=CC=C(C(=C1)C(=O)O)[O-] |
| InChI | InChI=1S/C7H6O3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8H,(H,9,10)/p-1 |
| InChIKey | YGSDEFSMJLZEOE-UHFFFAOYSA-M |
| XLogP | 2.40 |
| TPSA | 60.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | 133 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.11 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze Salicylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Salicylate?
The IUPAC name of Salicylate (CID 54675850) is 2-carboxyphenolate.
What is the SMILES notation for Salicylate?
The canonical SMILES for Salicylate is C1=CC=C(C(=C1)C(=O)O)[O-].
What is the InChIKey of Salicylate?
The InChIKey is YGSDEFSMJLZEOE-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H6O3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8H,(H,9,10)/p-1.
What are the key properties of Salicylate?
Salicylate has a molecular weight of 137.11 g/mol, XLogP of 2.40, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Salicylate is sourced from PubChem (CID 54675850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).