2,3-dihydroxybenzoic acid

C7H6O4 — CID 19

IUPAC2,3-dihydroxybenzoic acid
SMILESO=C(O)c1cccc(O)c1O
InChIInChI=1S/C7H6O4/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3,8-9H,(H,10,11)
InChIKeyGLDQAMYCGOIJDV-UHFFFAOYSA-N
MW154.12 g/mol
LogP0.80
Rot. Bonds1

About 2,3-dihydroxybenzoic acid

2,3-dihydroxybenzoic acid (PubChem CID 19) has the molecular formula C7H6O4 and a molecular weight of 154.12 g/mol. Its IUPAC name is 2,3-dihydroxybenzoic acid.

Molecular Properties

Compound Name2,3-dihydroxybenzoic acid
PubChem CID19
Molecular FormulaC7H6O4
Molecular Weight154.12 g/mol
Exact Mass154.03
IUPAC Name2,3-dihydroxybenzoic acid
SMILESO=C(O)c1cccc(O)c1O
InChIInChI=1S/C7H6O4/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3,8-9H,(H,10,11)
InChIKeyGLDQAMYCGOIJDV-UHFFFAOYSA-N
XLogP0.80
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500154.12
LogP ≤ 50.80
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}

Analyze 2,3-dihydroxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dihydroxybenzoic acid?
The IUPAC name of 2,3-dihydroxybenzoic acid (CID 19) is 2,3-dihydroxybenzoic acid.
What is the SMILES notation for 2,3-dihydroxybenzoic acid?
The canonical SMILES for 2,3-dihydroxybenzoic acid is O=C(O)c1cccc(O)c1O.
What is the InChIKey of 2,3-dihydroxybenzoic acid?
The InChIKey is GLDQAMYCGOIJDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O4/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3,8-9H,(H,10,11).
What are the key properties of 2,3-dihydroxybenzoic acid?
2,3-dihydroxybenzoic acid has a molecular weight of 154.12 g/mol, XLogP of 0.80, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxybenzoic acid is sourced from PubChem (CID 19), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).