C8H10N4O — CID 83779665
(6-methoxyimidazo[1,2-a]pyrimidin-2-yl)methanamine (PubChem CID 83779665) has the molecular formula C8H10N4O and a molecular weight of 178.19 g/mol. Its IUPAC name is (6-methoxyimidazo[1,2-a]pyrimidin-2-yl)methanamine.
| Compound Name | (6-methoxyimidazo[1,2-a]pyrimidin-2-yl)methanamine |
|---|---|
| PubChem CID | 83779665 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | (6-methoxyimidazo[1,2-a]pyrimidin-2-yl)methanamine |
| SMILES | COc1cnc2nc(CN)cn2c1 |
| InChI | InChI=1S/C8H10N4O/c1-13-7-3-10-8-11-6(2-9)4-12(8)5-7/h3-5H,2,9H2,1H3 |
| InChIKey | DBZMBAJMKXDAHL-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |