C20H18N4O — CID 122506562
4-methyl-3-[2-(phenoxymethyl)imidazo[1,2-a]pyrimidin-6-yl]aniline (PubChem CID 122506562) has the molecular formula C20H18N4O and a molecular weight of 330.39 g/mol. Its IUPAC name is 4-methyl-3-[2-(phenoxymethyl)imidazo[1,2-a]pyrimidin-6-yl]aniline.
| Compound Name | 4-methyl-3-[2-(phenoxymethyl)imidazo[1,2-a]pyrimidin-6-yl]aniline |
|---|---|
| PubChem CID | 122506562 |
| Molecular Formula | C20H18N4O |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 4-methyl-3-[2-(phenoxymethyl)imidazo[1,2-a]pyrimidin-6-yl]aniline |
| SMILES | Cc1ccc(N)cc1-c1cnc2nc(COc3ccccc3)cn2c1 |
| InChI | InChI=1S/C20H18N4O/c1-14-7-8-16(21)9-19(14)15-10-22-20-23-17(12-24(20)11-15)13-25-18-5-3-2-4-6-18/h2-12H,13,21H2,1H3 |
| InChIKey | XFCUZTLFILSNMU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|