C19H15FN4O — CID 122506719
6-(6-fluoro-4-methyl-3-pyridinyl)-2-(phenoxymethyl)imidazo[1,2-a]pyrimidine (PubChem CID 122506719) has the molecular formula C19H15FN4O and a molecular weight of 334.35 g/mol. Its IUPAC name is 6-(6-fluoro-4-methyl-3-pyridinyl)-2-(phenoxymethyl)imidazo[1,2-a]pyrimidine.
| Compound Name | 6-(6-fluoro-4-methyl-3-pyridinyl)-2-(phenoxymethyl)imidazo[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 122506719 |
| Molecular Formula | C19H15FN4O |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 6-(6-fluoro-4-methyl-3-pyridinyl)-2-(phenoxymethyl)imidazo[1,2-a]pyrimidine |
| SMILES | Cc1cc(F)ncc1-c1cnc2nc(COc3ccccc3)cn2c1 |
| InChI | InChI=1S/C19H15FN4O/c1-13-7-18(20)21-9-17(13)14-8-22-19-23-15(11-24(19)10-14)12-25-16-5-3-2-4-6-16/h2-11H,12H2,1H3 |
| InChIKey | WUOFCJKPYKXEBX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|