About 6-(2-methylcyclohexa-1,3-dien-1-yl)-2-(phenoxymethyl)imidazo[1,2-a]pyrimidine
6-(2-methylcyclohexa-1,3-dien-1-yl)-2-(phenoxymethyl)imidazo[1,2-a]pyrimidine (PubChem CID 155468144) has the molecular formula C20H19N3O
and a molecular weight of 317.39 g/mol. Its IUPAC name is 6-(2-methylcyclohexa-1,3-dien-1-yl)-2-(phenoxymethyl)imidazo[1,2-a]pyrimidine.
Molecular Properties
| Compound Name | 6-(2-methylcyclohexa-1,3-dien-1-yl)-2-(phenoxymethyl)imidazo[1,2-a]pyrimidine |
| PubChem CID | 155468144 |
| Molecular Formula | C20H19N3O |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 6-(2-methylcyclohexa-1,3-dien-1-yl)-2-(phenoxymethyl)imidazo[1,2-a]pyrimidine |
| SMILES | CC1=C(c2cnc3nc(COc4ccccc4)cn3c2)CCC=C1 |
| InChI | InChI=1S/C20H19N3O/c1-15-7-5-6-10-19(15)16-11-21-20-22-17(13-23(20)12-16)14-24-18-8-3-2-4-9-18/h2-5,7-9,11-13H,6,10,14H2,1H3 |
| InChIKey | LOZDDCLYGPSXEA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(2-methylcyclohexa-1,3-dien-1-yl)-2-(phenoxymethyl)imidazo[1,2-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-methylcyclohexa-1,3-dien-1-yl)-2-(phenoxymethyl)imidazo[1,2-a]pyrimidine?
The IUPAC name of 6-(2-methylcyclohexa-1,3-dien-1-yl)-2-(phenoxymethyl)imidazo[1,2-a]pyrimidine (CID 155468144) is 6-(2-methylcyclohexa-1,3-dien-1-yl)-2-(phenoxymethyl)imidazo[1,2-a]pyrimidine.
What is the SMILES notation for 6-(2-methylcyclohexa-1,3-dien-1-yl)-2-(phenoxymethyl)imidazo[1,2-a]pyrimidine?
The canonical SMILES for 6-(2-methylcyclohexa-1,3-dien-1-yl)-2-(phenoxymethyl)imidazo[1,2-a]pyrimidine is CC1=C(c2cnc3nc(COc4ccccc4)cn3c2)CCC=C1.
What is the InChIKey of 6-(2-methylcyclohexa-1,3-dien-1-yl)-2-(phenoxymethyl)imidazo[1,2-a]pyrimidine?
The InChIKey is LOZDDCLYGPSXEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3O/c1-15-7-5-6-10-19(15)16-11-21-20-22-17(13-23(20)12-16)14-24-18-8-3-2-4-9-18/h2-5,7-9,11-13H,6,10,14H2,1H3.
What are the key properties of 6-(2-methylcyclohexa-1,3-dien-1-yl)-2-(phenoxymethyl)imidazo[1,2-a]pyrimidine?
6-(2-methylcyclohexa-1,3-dien-1-yl)-2-(phenoxymethyl)imidazo[1,2-a]pyrimidine has a molecular weight of 317.39 g/mol, XLogP of 4.43, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-methylcyclohexa-1,3-dien-1-yl)-2-(phenoxymethyl)imidazo[1,2-a]pyrimidine is sourced from PubChem (CID 155468144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).