C9H11N3S — CID 83807722
3,5-dimethyl-1-thiophen-2-ylpyrazol-4-amine (PubChem CID 83807722) has the molecular formula C9H11N3S and a molecular weight of 193.28 g/mol. Its IUPAC name is 3,5-dimethyl-1-thiophen-2-ylpyrazol-4-amine.
| Compound Name | 3,5-dimethyl-1-thiophen-2-ylpyrazol-4-amine |
|---|---|
| PubChem CID | 83807722 |
| Molecular Formula | C9H11N3S |
| Molecular Weight | 193.28 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 3,5-dimethyl-1-thiophen-2-ylpyrazol-4-amine |
| SMILES | Cc1nn(-c2cccs2)c(C)c1N |
| InChI | InChI=1S/C9H11N3S/c1-6-9(10)7(2)12(11-6)8-4-3-5-13-8/h3-5H,10H2,1-2H3 |
| InChIKey | PNYWVZIXZGZRFN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |