About 2-fluoro-5-methylbenzoyl cyanide
2-fluoro-5-methylbenzoyl cyanide (PubChem CID 83808210) has the molecular formula C9H6FNO
and a molecular weight of 163.15 g/mol. Its IUPAC name is 2-fluoro-5-methylbenzoyl cyanide.
Molecular Properties
| Compound Name | 2-fluoro-5-methylbenzoyl cyanide |
| PubChem CID | 83808210 |
| Molecular Formula | C9H6FNO |
| Molecular Weight | 163.15 g/mol |
| Exact Mass | 163.04 |
| IUPAC Name | 2-fluoro-5-methylbenzoyl cyanide |
| SMILES | Cc1ccc(F)c(C(=O)C#N)c1 |
| InChI | InChI=1S/C9H6FNO/c1-6-2-3-8(10)7(4-6)9(12)5-11/h2-4H,1H3 |
| InChIKey | MAERKVZVKIOZGL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.15 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-5-methylbenzoyl cyanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-5-methylbenzoyl cyanide?
The IUPAC name of 2-fluoro-5-methylbenzoyl cyanide (CID 83808210) is 2-fluoro-5-methylbenzoyl cyanide.
What is the SMILES notation for 2-fluoro-5-methylbenzoyl cyanide?
The canonical SMILES for 2-fluoro-5-methylbenzoyl cyanide is Cc1ccc(F)c(C(=O)C#N)c1.
What is the InChIKey of 2-fluoro-5-methylbenzoyl cyanide?
The InChIKey is MAERKVZVKIOZGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6FNO/c1-6-2-3-8(10)7(4-6)9(12)5-11/h2-4H,1H3.
What are the key properties of 2-fluoro-5-methylbenzoyl cyanide?
2-fluoro-5-methylbenzoyl cyanide has a molecular weight of 163.15 g/mol, XLogP of 1.84, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-5-methylbenzoyl cyanide is sourced from PubChem (CID 83808210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).