About ethane;2-fluoro-5-methylbenzoyl chloride
ethane;2-fluoro-5-methylbenzoyl chloride (PubChem CID 143991429) has the molecular formula C10H12ClFO
and a molecular weight of 202.66 g/mol. Its IUPAC name is ethane;2-fluoro-5-methylbenzoyl chloride.
Molecular Properties
| Compound Name | ethane;2-fluoro-5-methylbenzoyl chloride |
| PubChem CID | 143991429 |
| Molecular Formula | C10H12ClFO |
| Molecular Weight | 202.66 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | ethane;2-fluoro-5-methylbenzoyl chloride |
| SMILES | CC.Cc1ccc(F)c(C(=O)Cl)c1 |
| InChI | InChI=1S/C8H6ClFO.C2H6/c1-5-2-3-7(10)6(4-5)8(9)11;1-2/h2-4H,1H3;1-2H3 |
| InChIKey | NLCUBURFFGNKJP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.66 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-fluoro-5-methylbenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-fluoro-5-methylbenzoyl chloride?
The IUPAC name of ethane;2-fluoro-5-methylbenzoyl chloride (CID 143991429) is ethane;2-fluoro-5-methylbenzoyl chloride.
What is the SMILES notation for ethane;2-fluoro-5-methylbenzoyl chloride?
The canonical SMILES for ethane;2-fluoro-5-methylbenzoyl chloride is CC.Cc1ccc(F)c(C(=O)Cl)c1.
What is the InChIKey of ethane;2-fluoro-5-methylbenzoyl chloride?
The InChIKey is NLCUBURFFGNKJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClFO.C2H6/c1-5-2-3-7(10)6(4-5)8(9)11;1-2/h2-4H,1H3;1-2H3.
What are the key properties of ethane;2-fluoro-5-methylbenzoyl chloride?
ethane;2-fluoro-5-methylbenzoyl chloride has a molecular weight of 202.66 g/mol, XLogP of 3.54, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-fluoro-5-methylbenzoyl chloride is sourced from PubChem (CID 143991429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).