C7H11N3OS — CID 83814579
1-methyl-3-[(5-methyl-1,3-oxazol-2-yl)methyl]thiourea (PubChem CID 83814579) has the molecular formula C7H11N3OS and a molecular weight of 185.25 g/mol. Its IUPAC name is 1-methyl-3-[(5-methyl-1,3-oxazol-2-yl)methyl]thiourea.
| Compound Name | 1-methyl-3-[(5-methyl-1,3-oxazol-2-yl)methyl]thiourea |
|---|---|
| PubChem CID | 83814579 |
| Molecular Formula | C7H11N3OS |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 1-methyl-3-[(5-methyl-1,3-oxazol-2-yl)methyl]thiourea |
| SMILES | CNC(=S)NCc1ncc(C)o1 |
| InChI | InChI=1S/C7H11N3OS/c1-5-3-9-6(11-5)4-10-7(12)8-2/h3H,4H2,1-2H3,(H2,8,10,12) |
| InChIKey | IHUZJNWOKXPQHS-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|