C7H3N3O — CID 83815222
1,2,3-benzoxadiazole-6-carbonitrile (PubChem CID 83815222) has the molecular formula C7H3N3O and a molecular weight of 145.12 g/mol. Its IUPAC name is 1,2,3-benzoxadiazole-6-carbonitrile.
| Compound Name | 1,2,3-benzoxadiazole-6-carbonitrile |
|---|---|
| PubChem CID | 83815222 |
| Molecular Formula | C7H3N3O |
| Molecular Weight | 145.12 g/mol |
| Exact Mass | 145.03 |
| IUPAC Name | 1,2,3-benzoxadiazole-6-carbonitrile |
| SMILES | N#Cc1ccc2nnoc2c1 |
| InChI | InChI=1S/C7H3N3O/c8-4-5-1-2-6-7(3-5)11-10-9-6/h1-3H |
| InChIKey | JFQYEQBIJJFXJV-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.12 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |