2-amino-5-methoxypyrimidine-4-carboxylic acid

C6H7N3O3 — CID 83816093

IUPAC2-amino-5-methoxypyrimidine-4-carboxylic acid
SMILESCOc1cnc(N)nc1C(=O)O
InChIInChI=1S/C6H7N3O3/c1-12-3-2-8-6(7)9-4(3)5(10)11/h2H,1H3,(H,10,11)(H2,7,8,9)
InChIKeyOVICJYZTYIMSAH-UHFFFAOYSA-N
MW169.14 g/mol
LogP-0.23
Rot. Bonds2

About 2-amino-5-methoxypyrimidine-4-carboxylic acid

2-amino-5-methoxypyrimidine-4-carboxylic acid (PubChem CID 83816093) has the molecular formula C6H7N3O3 and a molecular weight of 169.14 g/mol. Its IUPAC name is 2-amino-5-methoxypyrimidine-4-carboxylic acid.

Molecular Properties

Compound Name2-amino-5-methoxypyrimidine-4-carboxylic acid
PubChem CID83816093
Molecular FormulaC6H7N3O3
Molecular Weight169.14 g/mol
Exact Mass169.05
IUPAC Name2-amino-5-methoxypyrimidine-4-carboxylic acid
SMILESCOc1cnc(N)nc1C(=O)O
InChIInChI=1S/C6H7N3O3/c1-12-3-2-8-6(7)9-4(3)5(10)11/h2H,1H3,(H,10,11)(H2,7,8,9)
InChIKeyOVICJYZTYIMSAH-UHFFFAOYSA-N
XLogP-0.23
TPSA98.33 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500169.14
LogP ≤ 5-0.23
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-amino-5-methoxypyrimidine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-5-methoxypyrimidine-4-carboxylic acid?
The IUPAC name of 2-amino-5-methoxypyrimidine-4-carboxylic acid (CID 83816093) is 2-amino-5-methoxypyrimidine-4-carboxylic acid.
What is the SMILES notation for 2-amino-5-methoxypyrimidine-4-carboxylic acid?
The canonical SMILES for 2-amino-5-methoxypyrimidine-4-carboxylic acid is COc1cnc(N)nc1C(=O)O.
What is the InChIKey of 2-amino-5-methoxypyrimidine-4-carboxylic acid?
The InChIKey is OVICJYZTYIMSAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O3/c1-12-3-2-8-6(7)9-4(3)5(10)11/h2H,1H3,(H,10,11)(H2,7,8,9).
What are the key properties of 2-amino-5-methoxypyrimidine-4-carboxylic acid?
2-amino-5-methoxypyrimidine-4-carboxylic acid has a molecular weight of 169.14 g/mol, XLogP of -0.23, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-methoxypyrimidine-4-carboxylic acid is sourced from PubChem (CID 83816093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).