C6H7N3O3 — CID 83816093
2-amino-5-methoxypyrimidine-4-carboxylic acid (PubChem CID 83816093) has the molecular formula C6H7N3O3 and a molecular weight of 169.14 g/mol. Its IUPAC name is 2-amino-5-methoxypyrimidine-4-carboxylic acid.
| Compound Name | 2-amino-5-methoxypyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 83816093 |
| Molecular Formula | C6H7N3O3 |
| Molecular Weight | 169.14 g/mol |
| Exact Mass | 169.05 |
| IUPAC Name | 2-amino-5-methoxypyrimidine-4-carboxylic acid |
| SMILES | COc1cnc(N)nc1C(=O)O |
| InChI | InChI=1S/C6H7N3O3/c1-12-3-2-8-6(7)9-4(3)5(10)11/h2H,1H3,(H,10,11)(H2,7,8,9) |
| InChIKey | OVICJYZTYIMSAH-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.14 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |