C10H12N6O2 — CID 51063035
5-(2-amino-5-methoxypyrimidin-4-yl)-4-methoxypyrimidin-2-amine (PubChem CID 51063035) has the molecular formula C10H12N6O2 and a molecular weight of 248.25 g/mol. Its IUPAC name is 5-(2-amino-5-methoxypyrimidin-4-yl)-4-methoxypyrimidin-2-amine.
| Compound Name | 5-(2-amino-5-methoxypyrimidin-4-yl)-4-methoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 51063035 |
| Molecular Formula | C10H12N6O2 |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 5-(2-amino-5-methoxypyrimidin-4-yl)-4-methoxypyrimidin-2-amine |
| SMILES | COc1cnc(N)nc1-c1cnc(N)nc1OC |
| InChI | InChI=1S/C10H12N6O2/c1-17-6-4-14-9(11)15-7(6)5-3-13-10(12)16-8(5)18-2/h3-4H,1-2H3,(H2,11,14,15)(H2,12,13,16) |
| InChIKey | JKWLBKKFWSBPGI-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 122.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |