About (6-methylpyrimidin-4-yl) carbonochloridate
(6-methylpyrimidin-4-yl) carbonochloridate (PubChem CID 83816428) has the molecular formula C6H5ClN2O2
and a molecular weight of 172.57 g/mol. Its IUPAC name is (6-methylpyrimidin-4-yl) carbonochloridate.
Molecular Properties
| Compound Name | (6-methylpyrimidin-4-yl) carbonochloridate |
| PubChem CID | 83816428 |
| Molecular Formula | C6H5ClN2O2 |
| Molecular Weight | 172.57 g/mol |
| Exact Mass | 172.00 |
| IUPAC Name | (6-methylpyrimidin-4-yl) carbonochloridate |
| SMILES | Cc1cc(OC(=O)Cl)ncn1 |
| InChI | InChI=1S/C6H5ClN2O2/c1-4-2-5(9-3-8-4)11-6(7)10/h2-3H,1H3 |
| InChIKey | YKLCSYZKHWETIM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.57 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze (6-methylpyrimidin-4-yl) carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methylpyrimidin-4-yl) carbonochloridate?
The IUPAC name of (6-methylpyrimidin-4-yl) carbonochloridate (CID 83816428) is (6-methylpyrimidin-4-yl) carbonochloridate.
What is the SMILES notation for (6-methylpyrimidin-4-yl) carbonochloridate?
The canonical SMILES for (6-methylpyrimidin-4-yl) carbonochloridate is Cc1cc(OC(=O)Cl)ncn1.
What is the InChIKey of (6-methylpyrimidin-4-yl) carbonochloridate?
The InChIKey is YKLCSYZKHWETIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClN2O2/c1-4-2-5(9-3-8-4)11-6(7)10/h2-3H,1H3.
What are the key properties of (6-methylpyrimidin-4-yl) carbonochloridate?
(6-methylpyrimidin-4-yl) carbonochloridate has a molecular weight of 172.57 g/mol, XLogP of 1.52, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methylpyrimidin-4-yl) carbonochloridate is sourced from PubChem (CID 83816428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).