About (6-methylpyrimidin-4-yl) N-(3-aminopropyl)carbamate
(6-methylpyrimidin-4-yl) N-(3-aminopropyl)carbamate (PubChem CID 83820798) has the molecular formula C9H14N4O2
and a molecular weight of 210.24 g/mol. Its IUPAC name is (6-methylpyrimidin-4-yl) N-(3-aminopropyl)carbamate.
Molecular Properties
| Compound Name | (6-methylpyrimidin-4-yl) N-(3-aminopropyl)carbamate |
| PubChem CID | 83820798 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | (6-methylpyrimidin-4-yl) N-(3-aminopropyl)carbamate |
| SMILES | Cc1cc(OC(=O)NCCCN)ncn1 |
| InChI | InChI=1S/C9H14N4O2/c1-7-5-8(13-6-12-7)15-9(14)11-4-2-3-10/h5-6H,2-4,10H2,1H3,(H,11,14) |
| InChIKey | ABTNLSCYFISBOE-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (6-methylpyrimidin-4-yl) N-(3-aminopropyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methylpyrimidin-4-yl) N-(3-aminopropyl)carbamate?
The IUPAC name of (6-methylpyrimidin-4-yl) N-(3-aminopropyl)carbamate (CID 83820798) is (6-methylpyrimidin-4-yl) N-(3-aminopropyl)carbamate.
What is the SMILES notation for (6-methylpyrimidin-4-yl) N-(3-aminopropyl)carbamate?
The canonical SMILES for (6-methylpyrimidin-4-yl) N-(3-aminopropyl)carbamate is Cc1cc(OC(=O)NCCCN)ncn1.
What is the InChIKey of (6-methylpyrimidin-4-yl) N-(3-aminopropyl)carbamate?
The InChIKey is ABTNLSCYFISBOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4O2/c1-7-5-8(13-6-12-7)15-9(14)11-4-2-3-10/h5-6H,2-4,10H2,1H3,(H,11,14).
What are the key properties of (6-methylpyrimidin-4-yl) N-(3-aminopropyl)carbamate?
(6-methylpyrimidin-4-yl) N-(3-aminopropyl)carbamate has a molecular weight of 210.24 g/mol, XLogP of 0.22, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methylpyrimidin-4-yl) N-(3-aminopropyl)carbamate is sourced from PubChem (CID 83820798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).