About 2-(3-cyclopropyl-5-oxo-1,2-dihydropyrazol-4-yl)acetic acid
2-(3-cyclopropyl-5-oxo-1,2-dihydropyrazol-4-yl)acetic acid (PubChem CID 83817103) has the molecular formula C8H10N2O3
and a molecular weight of 182.18 g/mol. Its IUPAC name is 2-(3-cyclopropyl-5-oxo-1,2-dihydropyrazol-4-yl)acetic acid.
Analyze 2-(3-cyclopropyl-5-oxo-1,2-dihydropyrazol-4-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-cyclopropyl-5-oxo-1,2-dihydropyrazol-4-yl)acetic acid?
The IUPAC name of 2-(3-cyclopropyl-5-oxo-1,2-dihydropyrazol-4-yl)acetic acid (CID 83817103) is 2-(3-cyclopropyl-5-oxo-1,2-dihydropyrazol-4-yl)acetic acid.
What is the SMILES notation for 2-(3-cyclopropyl-5-oxo-1,2-dihydropyrazol-4-yl)acetic acid?
The canonical SMILES for 2-(3-cyclopropyl-5-oxo-1,2-dihydropyrazol-4-yl)acetic acid is O=C(O)Cc1c(C2CC2)[nH][nH]c1=O.
What is the InChIKey of 2-(3-cyclopropyl-5-oxo-1,2-dihydropyrazol-4-yl)acetic acid?
The InChIKey is WJOHJJDCCYTDFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O3/c11-6(12)3-5-7(4-1-2-4)9-10-8(5)13/h4H,1-3H2,(H,11,12)(H2,9,10,13).
What are the key properties of 2-(3-cyclopropyl-5-oxo-1,2-dihydropyrazol-4-yl)acetic acid?
2-(3-cyclopropyl-5-oxo-1,2-dihydropyrazol-4-yl)acetic acid has a molecular weight of 182.18 g/mol, XLogP of 0.21, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-cyclopropyl-5-oxo-1,2-dihydropyrazol-4-yl)acetic acid is sourced from PubChem (CID 83817103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).