C14H19NO — CID 83821795
2-(1-benzofuran-5-yl)-3,3-dimethylbutan-1-amine (PubChem CID 83821795) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 2-(1-benzofuran-5-yl)-3,3-dimethylbutan-1-amine.
| Compound Name | 2-(1-benzofuran-5-yl)-3,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 83821795 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 2-(1-benzofuran-5-yl)-3,3-dimethylbutan-1-amine |
| SMILES | CC(C)(C)C(CN)c1ccc2occc2c1 |
| InChI | InChI=1S/C14H19NO/c1-14(2,3)12(9-15)10-4-5-13-11(8-10)6-7-16-13/h4-8,12H,9,15H2,1-3H3 |
| InChIKey | PSDXHNBDOWFWGL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |