C11H11BrO3 — CID 171860132
1-(1-benzofuran-5-yl)-3-bromopropane-1,2-diol (PubChem CID 171860132) has the molecular formula C11H11BrO3 and a molecular weight of 271.11 g/mol. Its IUPAC name is 1-(1-benzofuran-5-yl)-3-bromopropane-1,2-diol.
| Compound Name | 1-(1-benzofuran-5-yl)-3-bromopropane-1,2-diol |
|---|---|
| PubChem CID | 171860132 |
| Molecular Formula | C11H11BrO3 |
| Molecular Weight | 271.11 g/mol |
| Exact Mass | 269.99 |
| IUPAC Name | 1-(1-benzofuran-5-yl)-3-bromopropane-1,2-diol |
| SMILES | OC(CBr)C(O)c1ccc2occc2c1 |
| InChI | InChI=1S/C11H11BrO3/c12-6-9(13)11(14)8-1-2-10-7(5-8)3-4-15-10/h1-5,9,11,13-14H,6H2 |
| InChIKey | LBULJBGMHJRAAR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.11 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|