C10H10ClN3O2 — CID 83824728
5-(2-aminoethyl)-3-(2-chlorophenyl)-1,3,4-oxadiazol-2-one (PubChem CID 83824728) has the molecular formula C10H10ClN3O2 and a molecular weight of 239.66 g/mol. Its IUPAC name is 5-(2-aminoethyl)-3-(2-chlorophenyl)-1,3,4-oxadiazol-2-one.
| Compound Name | 5-(2-aminoethyl)-3-(2-chlorophenyl)-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 83824728 |
| Molecular Formula | C10H10ClN3O2 |
| Molecular Weight | 239.66 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 5-(2-aminoethyl)-3-(2-chlorophenyl)-1,3,4-oxadiazol-2-one |
| SMILES | NCCc1nn(-c2ccccc2Cl)c(=O)o1 |
| InChI | InChI=1S/C10H10ClN3O2/c11-7-3-1-2-4-8(7)14-10(15)16-9(13-14)5-6-12/h1-4H,5-6,12H2 |
| InChIKey | HCGMHQFLEDOUEY-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.66 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |