C11H13ClN4 — CID 83868863
5-(2-aminoethyl)-1-(2-chlorophenyl)pyrazol-3-amine (PubChem CID 83868863) has the molecular formula C11H13ClN4 and a molecular weight of 236.71 g/mol. Its IUPAC name is 5-(2-aminoethyl)-1-(2-chlorophenyl)pyrazol-3-amine.
| Compound Name | 5-(2-aminoethyl)-1-(2-chlorophenyl)pyrazol-3-amine |
|---|---|
| PubChem CID | 83868863 |
| Molecular Formula | C11H13ClN4 |
| Molecular Weight | 236.71 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 5-(2-aminoethyl)-1-(2-chlorophenyl)pyrazol-3-amine |
| SMILES | NCCc1cc(N)nn1-c1ccccc1Cl |
| InChI | InChI=1S/C11H13ClN4/c12-9-3-1-2-4-10(9)16-8(5-6-13)7-11(14)15-16/h1-4,7H,5-6,13H2,(H2,14,15) |
| InChIKey | BBGDAFJIFYVHPS-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.71 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |