C8H10ClNO4S — CID 83825437
5-chlorosulfonyl-1,2,4-trimethylpyrrole-3-carboxylic acid (PubChem CID 83825437) has the molecular formula C8H10ClNO4S and a molecular weight of 251.69 g/mol. Its IUPAC name is 5-chlorosulfonyl-1,2,4-trimethylpyrrole-3-carboxylic acid.
| Compound Name | 5-chlorosulfonyl-1,2,4-trimethylpyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 83825437 |
| Molecular Formula | C8H10ClNO4S |
| Molecular Weight | 251.69 g/mol |
| Exact Mass | 251.00 |
| IUPAC Name | 5-chlorosulfonyl-1,2,4-trimethylpyrrole-3-carboxylic acid |
| SMILES | Cc1c(C(=O)O)c(C)n(C)c1S(=O)(=O)Cl |
| InChI | InChI=1S/C8H10ClNO4S/c1-4-6(8(11)12)5(2)10(3)7(4)15(9,13)14/h1-3H3,(H,11,12) |
| InChIKey | QZCCPXYCHRABQS-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.69 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |