5-chlorosulfonyl-1,2,4-trimethylpyrrole-3-carboxylic acid

C8H10ClNO4S — CID 83825437

IUPAC5-chlorosulfonyl-1,2,4-trimethylpyrrole-3-carboxylic acid
SMILESCc1c(C(=O)O)c(C)n(C)c1S(=O)(=O)Cl
InChIInChI=1S/C8H10ClNO4S/c1-4-6(8(11)12)5(2)10(3)7(4)15(9,13)14/h1-3H3,(H,11,12)
InChIKeyQZCCPXYCHRABQS-UHFFFAOYSA-N
MW251.69 g/mol
LogP1.27
Rot. Bonds2

About 5-chlorosulfonyl-1,2,4-trimethylpyrrole-3-carboxylic acid

5-chlorosulfonyl-1,2,4-trimethylpyrrole-3-carboxylic acid (PubChem CID 83825437) has the molecular formula C8H10ClNO4S and a molecular weight of 251.69 g/mol. Its IUPAC name is 5-chlorosulfonyl-1,2,4-trimethylpyrrole-3-carboxylic acid.

Molecular Properties

Compound Name5-chlorosulfonyl-1,2,4-trimethylpyrrole-3-carboxylic acid
PubChem CID83825437
Molecular FormulaC8H10ClNO4S
Molecular Weight251.69 g/mol
Exact Mass251.00
IUPAC Name5-chlorosulfonyl-1,2,4-trimethylpyrrole-3-carboxylic acid
SMILESCc1c(C(=O)O)c(C)n(C)c1S(=O)(=O)Cl
InChIInChI=1S/C8H10ClNO4S/c1-4-6(8(11)12)5(2)10(3)7(4)15(9,13)14/h1-3H3,(H,11,12)
InChIKeyQZCCPXYCHRABQS-UHFFFAOYSA-N
XLogP1.27
TPSA76.37 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.69
LogP ≤ 51.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5-chlorosulfonyl-1,2,4-trimethylpyrrole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-chlorosulfonyl-1,2,4-trimethylpyrrole-3-carboxylic acid?
The IUPAC name of 5-chlorosulfonyl-1,2,4-trimethylpyrrole-3-carboxylic acid (CID 83825437) is 5-chlorosulfonyl-1,2,4-trimethylpyrrole-3-carboxylic acid.
What is the SMILES notation for 5-chlorosulfonyl-1,2,4-trimethylpyrrole-3-carboxylic acid?
The canonical SMILES for 5-chlorosulfonyl-1,2,4-trimethylpyrrole-3-carboxylic acid is Cc1c(C(=O)O)c(C)n(C)c1S(=O)(=O)Cl.
What is the InChIKey of 5-chlorosulfonyl-1,2,4-trimethylpyrrole-3-carboxylic acid?
The InChIKey is QZCCPXYCHRABQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClNO4S/c1-4-6(8(11)12)5(2)10(3)7(4)15(9,13)14/h1-3H3,(H,11,12).
What are the key properties of 5-chlorosulfonyl-1,2,4-trimethylpyrrole-3-carboxylic acid?
5-chlorosulfonyl-1,2,4-trimethylpyrrole-3-carboxylic acid has a molecular weight of 251.69 g/mol, XLogP of 1.27, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chlorosulfonyl-1,2,4-trimethylpyrrole-3-carboxylic acid is sourced from PubChem (CID 83825437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).