C6H10N4O — CID 83826424
1-(3-methoxy-1,2,4-triazin-6-yl)ethanamine (PubChem CID 83826424) has the molecular formula C6H10N4O and a molecular weight of 154.17 g/mol. Its IUPAC name is 1-(3-methoxy-1,2,4-triazin-6-yl)ethanamine.
| Compound Name | 1-(3-methoxy-1,2,4-triazin-6-yl)ethanamine |
|---|---|
| PubChem CID | 83826424 |
| Molecular Formula | C6H10N4O |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | 1-(3-methoxy-1,2,4-triazin-6-yl)ethanamine |
| SMILES | COc1ncc(C(C)N)nn1 |
| InChI | InChI=1S/C6H10N4O/c1-4(7)5-3-8-6(11-2)10-9-5/h3-4H,7H2,1-2H3 |
| InChIKey | LZCOIMPNBHWURW-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |