C15H15NO5S — CID 838288
ethyl 2-acetamido-7-acetyloxy-1-benzothiophene-3-carboxylate (PubChem CID 838288) has the molecular formula C15H15NO5S and a molecular weight of 321.35 g/mol. Its IUPAC name is ethyl 2-acetamido-7-acetyloxy-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-acetamido-7-acetyloxy-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 838288 |
| Molecular Formula | C15H15NO5S |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | ethyl 2-acetamido-7-acetyloxy-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(C)=O)sc2c(OC(C)=O)cccc12 |
| InChI | InChI=1S/C15H15NO5S/c1-4-20-15(19)12-10-6-5-7-11(21-9(3)18)13(10)22-14(12)16-8(2)17/h5-7H,4H2,1-3H3,(H,16,17) |
| InChIKey | DOAIKKOAESVIAQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|