C11H15N3 — CID 83829303
1-methyl-3-propan-2-ylimidazo[1,5-a]pyridin-7-amine (PubChem CID 83829303) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is 1-methyl-3-propan-2-ylimidazo[1,5-a]pyridin-7-amine.
| Compound Name | 1-methyl-3-propan-2-ylimidazo[1,5-a]pyridin-7-amine |
|---|---|
| PubChem CID | 83829303 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 1-methyl-3-propan-2-ylimidazo[1,5-a]pyridin-7-amine |
| SMILES | Cc1nc(C(C)C)n2ccc(N)cc12 |
| InChI | InChI=1S/C11H15N3/c1-7(2)11-13-8(3)10-6-9(12)4-5-14(10)11/h4-7H,12H2,1-3H3 |
| InChIKey | DSBNIIVCUXARBI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |