C11H14N2 — CID 154464796
1,2,3-trimethylindolizin-7-amine (PubChem CID 154464796) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 1,2,3-trimethylindolizin-7-amine.
| Compound Name | 1,2,3-trimethylindolizin-7-amine |
|---|---|
| PubChem CID | 154464796 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 1,2,3-trimethylindolizin-7-amine |
| SMILES | Cc1c(C)c2cc(N)ccn2c1C |
| InChI | InChI=1S/C11H14N2/c1-7-8(2)11-6-10(12)4-5-13(11)9(7)3/h4-6H,12H2,1-3H3 |
| InChIKey | SZJKQGPOHBJVBT-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 30.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |