C12H23NO — CID 83831424
1-(4,4-dimethylcyclohexyl)pyrrolidin-3-ol (PubChem CID 83831424) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 1-(4,4-dimethylcyclohexyl)pyrrolidin-3-ol.
| Compound Name | 1-(4,4-dimethylcyclohexyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 83831424 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 1-(4,4-dimethylcyclohexyl)pyrrolidin-3-ol |
| SMILES | CC1(C)CCC(N2CCC(O)C2)CC1 |
| InChI | InChI=1S/C12H23NO/c1-12(2)6-3-10(4-7-12)13-8-5-11(14)9-13/h10-11,14H,3-9H2,1-2H3 |
| InChIKey | PDCURHPZGDGNNR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |